C9H16N2O — CID 91306005
1-methyl-N-prop-1-en-2-ylpyrrolidine-2-carboxamide (PubChem CID 91306005) has the molecular formula C9H16N2O and a molecular weight of 168.24 g/mol. Its IUPAC name is 1-methyl-N-prop-1-en-2-ylpyrrolidine-2-carboxamide.
| Compound Name | 1-methyl-N-prop-1-en-2-ylpyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 91306005 |
| Molecular Formula | C9H16N2O |
| Molecular Weight | 168.24 g/mol |
| Exact Mass | 168.13 |
| IUPAC Name | 1-methyl-N-prop-1-en-2-ylpyrrolidine-2-carboxamide |
| SMILES | C=C(C)NC(=O)C1CCCN1C |
| InChI | InChI=1S/C9H16N2O/c1-7(2)10-9(12)8-5-4-6-11(8)3/h8H,1,4-6H2,2-3H3,(H,10,12) |
| InChIKey | FMSNZOWIKYEZCS-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.24 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |