C21H36F2N4O7 — CID 177357047
(2R,3R,4R,5R,6R)-5-[[6-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]-1,1-difluoroethyl]pyrazin-2-yl]amino]-2-(hydroxymethyl)-6-propyloxane-3,4-diol (PubChem CID 177357047) has the molecular formula C21H36F2N4O7 and a molecular weight of 494.54 g/mol. Its IUPAC name is (2R,3R,4R,5R,6R)-5-[[6-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]-1,1-difluoroethyl]pyrazin-2-yl]amino]-2-(hydroxymethyl)-6-propyloxane-3,4-diol.
| Compound Name | (2R,3R,4R,5R,6R)-5-[[6-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]-1,1-difluoroethyl]pyrazin-2-yl]amino]-2-(hydroxymethyl)-6-propyloxane-3,4-diol |
|---|---|
| PubChem CID | 177357047 |
| Molecular Formula | C21H36F2N4O7 |
| Molecular Weight | 494.54 g/mol |
| Exact Mass | 494.26 |
| IUPAC Name | (2R,3R,4R,5R,6R)-5-[[6-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]-1,1-difluoroethyl]pyrazin-2-yl]amino]-2-(hydroxymethyl)-6-propyloxane-3,4-diol |
| SMILES | CCC[C@H]1O[C@H](CO)[C@H](O)[C@H](O)[C@H]1Nc1cncc(C(F)(F)COCCOCCOCCN)n1 |
| InChI | InChI=1S/C21H36F2N4O7/c1-2-3-14-18(20(30)19(29)15(12-28)34-14)27-17-11-25-10-16(26-17)21(22,23)13-33-9-8-32-7-6-31-5-4-24/h10-11,14-15,18-20,28-30H,2-9,12-13,24H2,1H3,(H,26,27)/t14-,15-,18+,19+,20-/m1/s1 |
| InChIKey | QQNIEEFTVPQFAU-PYIJOLGTSA-N |
| XLogP | -0.36 |
| TPSA | 161.44 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.54 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|