C20H20N2O3 — CID 177359311
2-[(1R)-1-cyano-2-methylcyclopropyl]-7-(oxan-4-yl)quinoline-3-carboxylic acid (PubChem CID 177359311) has the molecular formula C20H20N2O3 and a molecular weight of 336.39 g/mol. Its IUPAC name is 2-[(1R)-1-cyano-2-methylcyclopropyl]-7-(oxan-4-yl)quinoline-3-carboxylic acid.
| Compound Name | 2-[(1R)-1-cyano-2-methylcyclopropyl]-7-(oxan-4-yl)quinoline-3-carboxylic acid |
|---|---|
| PubChem CID | 177359311 |
| Molecular Formula | C20H20N2O3 |
| Molecular Weight | 336.39 g/mol |
| Exact Mass | 336.15 |
| IUPAC Name | 2-[(1R)-1-cyano-2-methylcyclopropyl]-7-(oxan-4-yl)quinoline-3-carboxylic acid |
| SMILES | CC1C[C@]1(C#N)c1nc2cc(C3CCOCC3)ccc2cc1C(=O)O |
| InChI | InChI=1S/C20H20N2O3/c1-12-10-20(12,11-21)18-16(19(23)24)8-15-3-2-14(9-17(15)22-18)13-4-6-25-7-5-13/h2-3,8-9,12-13H,4-7,10H2,1H3,(H,23,24)/t12?,20-/m1/s1 |
| InChIKey | HUDJPWXLODXXHY-VLFLDKFOSA-N |
| XLogP | 3.63 |
| TPSA | 83.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.39 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |