6-(2,2-dimethyloxan-4-yl)quinoline-4-carboxylic acid

C17H19NO3 — CID 175960459

IUPAC6-(2,2-dimethyloxan-4-yl)quinoline-4-carboxylic acid
SMILESCC1(C)CC(c2ccc3nccc(C(=O)O)c3c2)CCO1
InChIInChI=1S/C17H19NO3/c1-17(2)10-12(6-8-21-17)11-3-4-15-14(9-11)13(16(19)20)5-7-18-15/h3-5,7,9,12H,6,8,10H2,1-2H3,(H,19,20)
InChIKeyAXQKOVVECSDBBP-UHFFFAOYSA-N
MW285.34 g/mol
LogP3.61
Rot. Bonds2

About 6-(2,2-dimethyloxan-4-yl)quinoline-4-carboxylic acid

6-(2,2-dimethyloxan-4-yl)quinoline-4-carboxylic acid (PubChem CID 175960459) has the molecular formula C17H19NO3 and a molecular weight of 285.34 g/mol. Its IUPAC name is 6-(2,2-dimethyloxan-4-yl)quinoline-4-carboxylic acid.

Molecular Properties

Compound Name6-(2,2-dimethyloxan-4-yl)quinoline-4-carboxylic acid
PubChem CID175960459
Molecular FormulaC17H19NO3
Molecular Weight285.34 g/mol
Exact Mass285.14
IUPAC Name6-(2,2-dimethyloxan-4-yl)quinoline-4-carboxylic acid
SMILESCC1(C)CC(c2ccc3nccc(C(=O)O)c3c2)CCO1
InChIInChI=1S/C17H19NO3/c1-17(2)10-12(6-8-21-17)11-3-4-15-14(9-11)13(16(19)20)5-7-18-15/h3-5,7,9,12H,6,8,10H2,1-2H3,(H,19,20)
InChIKeyAXQKOVVECSDBBP-UHFFFAOYSA-N
XLogP3.61
TPSA59.42 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms21
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500285.34
LogP ≤ 53.61
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 6-(2,2-dimethyloxan-4-yl)quinoline-4-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 6-(2,2-dimethyloxan-4-yl)quinoline-4-carboxylic acid?
The IUPAC name of 6-(2,2-dimethyloxan-4-yl)quinoline-4-carboxylic acid (CID 175960459) is 6-(2,2-dimethyloxan-4-yl)quinoline-4-carboxylic acid.
What is the SMILES notation for 6-(2,2-dimethyloxan-4-yl)quinoline-4-carboxylic acid?
The canonical SMILES for 6-(2,2-dimethyloxan-4-yl)quinoline-4-carboxylic acid is CC1(C)CC(c2ccc3nccc(C(=O)O)c3c2)CCO1.
What is the InChIKey of 6-(2,2-dimethyloxan-4-yl)quinoline-4-carboxylic acid?
The InChIKey is AXQKOVVECSDBBP-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H19NO3/c1-17(2)10-12(6-8-21-17)11-3-4-15-14(9-11)13(16(19)20)5-7-18-15/h3-5,7,9,12H,6,8,10H2,1-2H3,(H,19,20).
What are the key properties of 6-(2,2-dimethyloxan-4-yl)quinoline-4-carboxylic acid?
6-(2,2-dimethyloxan-4-yl)quinoline-4-carboxylic acid has a molecular weight of 285.34 g/mol, XLogP of 3.61, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(2,2-dimethyloxan-4-yl)quinoline-4-carboxylic acid is sourced from PubChem (CID 175960459), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).