About 2,5-dimethyl-10-(4-methylphenyl)sulfonylindolo[3,2-b]quinolin-5-ium chloride
2,5-dimethyl-10-(4-methylphenyl)sulfonylindolo[3,2-b]quinolin-5-ium chloride (PubChem CID 177360736) has the molecular formula C24H21ClN2O2S
and a molecular weight of 436.96 g/mol. Its IUPAC name is 2,5-dimethyl-10-(4-methylphenyl)sulfonylindolo[3,2-b]quinolin-5-ium chloride.
Molecular Properties
| Compound Name | 2,5-dimethyl-10-(4-methylphenyl)sulfonylindolo[3,2-b]quinolin-5-ium chloride |
| PubChem CID | 177360736 |
| Molecular Formula | C24H21ClN2O2S |
| Molecular Weight | 436.96 g/mol |
| Exact Mass | 436.10 |
| IUPAC Name | 2,5-dimethyl-10-(4-methylphenyl)sulfonylindolo[3,2-b]quinolin-5-ium chloride |
| SMILES | Cc1ccc(S(=O)(=O)n2c3ccccc3c3c2cc2cc(C)ccc2[n+]3C)cc1.[Cl-] |
| InChI | InChI=1S/C24H21N2O2S.ClH/c1-16-8-11-19(12-9-16)29(27,28)26-22-7-5-4-6-20(22)24-23(26)15-18-14-17(2)10-13-21(18)25(24)3;/h4-15H,1-3H3;1H/q+1;/p-1 |
| InChIKey | MQAHGEYJKXHOLO-UHFFFAOYSA-M |
| XLogP | 1.63 |
| TPSA | 42.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 436.96 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het_pyridiniums_A(39)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 2,5-dimethyl-10-(4-methylphenyl)sulfonylindolo[3,2-b]quinolin-5-ium chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,5-dimethyl-10-(4-methylphenyl)sulfonylindolo[3,2-b]quinolin-5-ium chloride?
The IUPAC name of 2,5-dimethyl-10-(4-methylphenyl)sulfonylindolo[3,2-b]quinolin-5-ium chloride (CID 177360736) is 2,5-dimethyl-10-(4-methylphenyl)sulfonylindolo[3,2-b]quinolin-5-ium chloride.
What is the SMILES notation for 2,5-dimethyl-10-(4-methylphenyl)sulfonylindolo[3,2-b]quinolin-5-ium chloride?
The canonical SMILES for 2,5-dimethyl-10-(4-methylphenyl)sulfonylindolo[3,2-b]quinolin-5-ium chloride is Cc1ccc(S(=O)(=O)n2c3ccccc3c3c2cc2cc(C)ccc2[n+]3C)cc1.[Cl-].
What is the InChIKey of 2,5-dimethyl-10-(4-methylphenyl)sulfonylindolo[3,2-b]quinolin-5-ium chloride?
The InChIKey is MQAHGEYJKXHOLO-UHFFFAOYSA-M. The full InChI is InChI=1S/C24H21N2O2S.ClH/c1-16-8-11-19(12-9-16)29(27,28)26-22-7-5-4-6-20(22)24-23(26)15-18-14-17(2)10-13-21(18)25(24)3;/h4-15H,1-3H3;1H/q+1;/p-1.
What are the key properties of 2,5-dimethyl-10-(4-methylphenyl)sulfonylindolo[3,2-b]quinolin-5-ium chloride?
2,5-dimethyl-10-(4-methylphenyl)sulfonylindolo[3,2-b]quinolin-5-ium chloride has a molecular weight of 436.96 g/mol, XLogP of 1.63, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,5-dimethyl-10-(4-methylphenyl)sulfonylindolo[3,2-b]quinolin-5-ium chloride is sourced from PubChem (CID 177360736), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).