C27H38N6O2 — CID 177363457
N-[4-[4-[[1-(4-aminophenyl)piperidin-4-yl]methyl]piperazin-1-yl]-2-methylphenyl]-3-formamidopropanamide (PubChem CID 177363457) has the molecular formula C27H38N6O2 and a molecular weight of 478.64 g/mol. Its IUPAC name is N-[4-[4-[[1-(4-aminophenyl)piperidin-4-yl]methyl]piperazin-1-yl]-2-methylphenyl]-3-formamidopropanamide.
| Compound Name | N-[4-[4-[[1-(4-aminophenyl)piperidin-4-yl]methyl]piperazin-1-yl]-2-methylphenyl]-3-formamidopropanamide |
|---|---|
| PubChem CID | 177363457 |
| Molecular Formula | C27H38N6O2 |
| Molecular Weight | 478.64 g/mol |
| Exact Mass | 478.31 |
| IUPAC Name | N-[4-[4-[[1-(4-aminophenyl)piperidin-4-yl]methyl]piperazin-1-yl]-2-methylphenyl]-3-formamidopropanamide |
| SMILES | Cc1cc(N2CCN(CC3CCN(c4ccc(N)cc4)CC3)CC2)ccc1NC(=O)CCNC=O |
| InChI | InChI=1S/C27H38N6O2/c1-21-18-25(6-7-26(21)30-27(35)8-11-29-20-34)33-16-14-31(15-17-33)19-22-9-12-32(13-10-22)24-4-2-23(28)3-5-24/h2-7,18,20,22H,8-17,19,28H2,1H3,(H,29,34)(H,30,35) |
| InChIKey | CJNSKSGBKKADQW-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 93.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.64 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|