C12H17NO — CID 177363478
6-methyl-5-[(2Z)-3-methylhexa-2,4,5-trien-2-yl]-3,4-dihydro-2H-1,4-oxazine (PubChem CID 177363478) has the molecular formula C12H17NO and a molecular weight of 191.27 g/mol. Its IUPAC name is 6-methyl-5-[(2Z)-3-methylhexa-2,4,5-trien-2-yl]-3,4-dihydro-2H-1,4-oxazine.
| Compound Name | 6-methyl-5-[(2Z)-3-methylhexa-2,4,5-trien-2-yl]-3,4-dihydro-2H-1,4-oxazine |
|---|---|
| PubChem CID | 177363478 |
| Molecular Formula | C12H17NO |
| Molecular Weight | 191.27 g/mol |
| Exact Mass | 191.13 |
| IUPAC Name | 6-methyl-5-[(2Z)-3-methylhexa-2,4,5-trien-2-yl]-3,4-dihydro-2H-1,4-oxazine |
| SMILES | C=C=C/C(C)=C(/C)C1=C(C)OCCN1 |
| InChI | InChI=1S/C12H17NO/c1-5-6-9(2)10(3)12-11(4)14-8-7-13-12/h6,13H,1,7-8H2,2-4H3/b10-9- |
| InChIKey | LXCMOGHPRCGHEZ-KTKRTIGZSA-N |
| XLogP | 2.52 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.27 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|