C17H29N3O4 — CID 177364924
tert-butyl (2S,5R)-2-(2-hydroxypropan-2-yloxymethyl)-5-(2-methylpyrazol-3-yl)pyrrolidine-1-carboxylate (PubChem CID 177364924) has the molecular formula C17H29N3O4 and a molecular weight of 339.44 g/mol. Its IUPAC name is tert-butyl (2S,5R)-2-(2-hydroxypropan-2-yloxymethyl)-5-(2-methylpyrazol-3-yl)pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2S,5R)-2-(2-hydroxypropan-2-yloxymethyl)-5-(2-methylpyrazol-3-yl)pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 177364924 |
| Molecular Formula | C17H29N3O4 |
| Molecular Weight | 339.44 g/mol |
| Exact Mass | 339.22 |
| IUPAC Name | tert-butyl (2S,5R)-2-(2-hydroxypropan-2-yloxymethyl)-5-(2-methylpyrazol-3-yl)pyrrolidine-1-carboxylate |
| SMILES | Cn1nccc1[C@H]1CC[C@@H](COC(C)(C)O)N1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C17H29N3O4/c1-16(2,3)24-15(21)20-12(11-23-17(4,5)22)7-8-14(20)13-9-10-18-19(13)6/h9-10,12,14,22H,7-8,11H2,1-6H3/t12-,14+/m0/s1 |
| InChIKey | KUFAWKRSGJEHFE-GXTWGEPZSA-N |
| XLogP | 2.61 |
| TPSA | 76.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.44 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|