C19H33N3O3Si — CID 67705622
prop-2-enyl (2R,4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-[(2-methylpyrazol-3-yl)methyl]pyrrolidine-1-carboxylate (PubChem CID 67705622) has the molecular formula C19H33N3O3Si and a molecular weight of 379.58 g/mol. Its IUPAC name is prop-2-enyl (2R,4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-[(2-methylpyrazol-3-yl)methyl]pyrrolidine-1-carboxylate.
| Compound Name | prop-2-enyl (2R,4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-[(2-methylpyrazol-3-yl)methyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 67705622 |
| Molecular Formula | C19H33N3O3Si |
| Molecular Weight | 379.58 g/mol |
| Exact Mass | 379.23 |
| IUPAC Name | prop-2-enyl (2R,4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-[(2-methylpyrazol-3-yl)methyl]pyrrolidine-1-carboxylate |
| SMILES | C=CCOC(=O)N1C[C@H](O[Si](C)(C)C(C)(C)C)C[C@H]1Cc1ccnn1C |
| InChI | InChI=1S/C19H33N3O3Si/c1-8-11-24-18(23)22-14-17(25-26(6,7)19(2,3)4)13-16(22)12-15-9-10-20-21(15)5/h8-10,16-17H,1,11-14H2,2-7H3/t16-,17-/m1/s1 |
| InChIKey | PTTYWEMIPPNEIG-IAGOWNOFSA-N |
| XLogP | 3.75 |
| TPSA | 56.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.58 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|