C21H39NO5Si — CID 177365320
1-O-tert-butyl 2-O-methyl (2S,4S)-5-methylidene-4-tri(propan-2-yl)silyloxypyrrolidine-1,2-dicarboxylate (PubChem CID 177365320) has the molecular formula C21H39NO5Si and a molecular weight of 413.63 g/mol. Its IUPAC name is 1-O-tert-butyl 2-O-methyl (2S,4S)-5-methylidene-4-tri(propan-2-yl)silyloxypyrrolidine-1,2-dicarboxylate.
| Compound Name | 1-O-tert-butyl 2-O-methyl (2S,4S)-5-methylidene-4-tri(propan-2-yl)silyloxypyrrolidine-1,2-dicarboxylate |
|---|---|
| PubChem CID | 177365320 |
| Molecular Formula | C21H39NO5Si |
| Molecular Weight | 413.63 g/mol |
| Exact Mass | 413.26 |
| IUPAC Name | 1-O-tert-butyl 2-O-methyl (2S,4S)-5-methylidene-4-tri(propan-2-yl)silyloxypyrrolidine-1,2-dicarboxylate |
| SMILES | C=C1[C@@H](O[Si](C(C)C)(C(C)C)C(C)C)C[C@@H](C(=O)OC)N1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C21H39NO5Si/c1-13(2)28(14(3)4,15(5)6)27-18-12-17(19(23)25-11)22(16(18)7)20(24)26-21(8,9)10/h13-15,17-18H,7,12H2,1-6,8-11H3/t17-,18-/m0/s1 |
| InChIKey | KWRYNZYYHNODOJ-ROUUACIJSA-N |
| XLogP | 5.24 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.63 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|