C21H36BF2N3O5 — CID 177367579
tert-butyl N-(2,2-difluoroethyl)-N-[(2S)-2-[2,5-dimethyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-3-yl]oxypropyl]carbamate (PubChem CID 177367579) has the molecular formula C21H36BF2N3O5 and a molecular weight of 459.34 g/mol. Its IUPAC name is tert-butyl N-(2,2-difluoroethyl)-N-[(2S)-2-[2,5-dimethyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-3-yl]oxypropyl]carbamate.
| Compound Name | tert-butyl N-(2,2-difluoroethyl)-N-[(2S)-2-[2,5-dimethyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-3-yl]oxypropyl]carbamate |
|---|---|
| PubChem CID | 177367579 |
| Molecular Formula | C21H36BF2N3O5 |
| Molecular Weight | 459.34 g/mol |
| Exact Mass | 459.27 |
| IUPAC Name | tert-butyl N-(2,2-difluoroethyl)-N-[(2S)-2-[2,5-dimethyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-3-yl]oxypropyl]carbamate |
| SMILES | Cc1nn(C)c(O[C@@H](C)CN(CC(F)F)C(=O)OC(C)(C)C)c1B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C21H36BF2N3O5/c1-13(11-27(12-15(23)24)18(28)30-19(3,4)5)29-17-16(14(2)25-26(17)10)22-31-20(6,7)21(8,9)32-22/h13,15H,11-12H2,1-10H3/t13-/m0/s1 |
| InChIKey | AASXOAJZDUHMEG-ZDUSSCGKSA-N |
| XLogP | 3.30 |
| TPSA | 75.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.34 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|