C18H34N4O — CID 177368261
1-[3-[4-(3-aminopropylamino)butylamino]propylamino]-1-phenylethanol (PubChem CID 177368261) has the molecular formula C18H34N4O and a molecular weight of 322.50 g/mol. Its IUPAC name is 1-[3-[4-(3-aminopropylamino)butylamino]propylamino]-1-phenylethanol.
| Compound Name | 1-[3-[4-(3-aminopropylamino)butylamino]propylamino]-1-phenylethanol |
|---|---|
| PubChem CID | 177368261 |
| Molecular Formula | C18H34N4O |
| Molecular Weight | 322.50 g/mol |
| Exact Mass | 322.27 |
| IUPAC Name | 1-[3-[4-(3-aminopropylamino)butylamino]propylamino]-1-phenylethanol |
| SMILES | CC(O)(NCCCNCCCCNCCCN)c1ccccc1 |
| InChI | InChI=1S/C18H34N4O/c1-18(23,17-9-3-2-4-10-17)22-16-8-15-21-13-6-5-12-20-14-7-11-19/h2-4,9-10,20-23H,5-8,11-16,19H2,1H3 |
| InChIKey | BYSLZRXLZBKYIA-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 82.34 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.50 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|