C28H34F3N5O3 — CID 177368727
N-[(2S)-1,1-dicyclopropyl-3-oxo-3-[[(1R)-1-(3,3,3-trifluoropropanoylamino)-2,3-dihydro-1H-inden-5-yl]amino]propan-2-yl]-2-propan-2-ylpyrazole-3-carboxamide (PubChem CID 177368727) has the molecular formula C28H34F3N5O3 and a molecular weight of 545.61 g/mol. Its IUPAC name is N-[(2S)-1,1-dicyclopropyl-3-oxo-3-[[(1R)-1-(3,3,3-trifluoropropanoylamino)-2,3-dihydro-1H-inden-5-yl]amino]propan-2-yl]-2-propan-2-ylpyrazole-3-carboxamide.
| Compound Name | N-[(2S)-1,1-dicyclopropyl-3-oxo-3-[[(1R)-1-(3,3,3-trifluoropropanoylamino)-2,3-dihydro-1H-inden-5-yl]amino]propan-2-yl]-2-propan-2-ylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 177368727 |
| Molecular Formula | C28H34F3N5O3 |
| Molecular Weight | 545.61 g/mol |
| Exact Mass | 545.26 |
| IUPAC Name | N-[(2S)-1,1-dicyclopropyl-3-oxo-3-[[(1R)-1-(3,3,3-trifluoropropanoylamino)-2,3-dihydro-1H-inden-5-yl]amino]propan-2-yl]-2-propan-2-ylpyrazole-3-carboxamide |
| SMILES | CC(C)n1nccc1C(=O)N[C@H](C(=O)Nc1ccc2c(c1)CC[C@H]2NC(=O)CC(F)(F)F)C(C1CC1)C1CC1 |
| InChI | InChI=1S/C28H34F3N5O3/c1-15(2)36-22(11-12-32-36)26(38)35-25(24(16-3-4-16)17-5-6-17)27(39)33-19-8-9-20-18(13-19)7-10-21(20)34-23(37)14-28(29,30)31/h8-9,11-13,15-17,21,24-25H,3-7,10,14H2,1-2H3,(H,33,39)(H,34,37)(H,35,38)/t21-,25+/m1/s1 |
| InChIKey | PIKPMUVKZTYWIB-BWKNWUBXSA-N |
| XLogP | 4.69 |
| TPSA | 105.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.61 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |