C28H34F3N5O4 — CID 177368785
N-[1,1-dicyclopropyl-3-oxo-3-[[(1R)-1-(2,2,2-trifluoroethylcarbamoyl)-3,4-dihydro-1H-isochromen-6-yl]amino]propan-2-yl]-2-propan-2-ylpyrazole-3-carboxamide (PubChem CID 177368785) has the molecular formula C28H34F3N5O4 and a molecular weight of 561.61 g/mol. Its IUPAC name is N-[1,1-dicyclopropyl-3-oxo-3-[[(1R)-1-(2,2,2-trifluoroethylcarbamoyl)-3,4-dihydro-1H-isochromen-6-yl]amino]propan-2-yl]-2-propan-2-ylpyrazole-3-carboxamide.
| Compound Name | N-[1,1-dicyclopropyl-3-oxo-3-[[(1R)-1-(2,2,2-trifluoroethylcarbamoyl)-3,4-dihydro-1H-isochromen-6-yl]amino]propan-2-yl]-2-propan-2-ylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 177368785 |
| Molecular Formula | C28H34F3N5O4 |
| Molecular Weight | 561.61 g/mol |
| Exact Mass | 561.26 |
| IUPAC Name | N-[1,1-dicyclopropyl-3-oxo-3-[[(1R)-1-(2,2,2-trifluoroethylcarbamoyl)-3,4-dihydro-1H-isochromen-6-yl]amino]propan-2-yl]-2-propan-2-ylpyrazole-3-carboxamide |
| SMILES | CC(C)n1nccc1C(=O)NC(C(=O)Nc1ccc2c(c1)CCO[C@H]2C(=O)NCC(F)(F)F)C(C1CC1)C1CC1 |
| InChI | InChI=1S/C28H34F3N5O4/c1-15(2)36-21(9-11-33-36)25(37)35-23(22(16-3-4-16)17-5-6-17)26(38)34-19-7-8-20-18(13-19)10-12-40-24(20)27(39)32-14-28(29,30)31/h7-9,11,13,15-17,22-24H,3-6,10,12,14H2,1-2H3,(H,32,39)(H,34,38)(H,35,37)/t23?,24-/m1/s1 |
| InChIKey | GYAGIDKYZKDXNN-XMMISQBUSA-N |
| XLogP | 3.93 |
| TPSA | 114.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.61 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |