C15H30N2O — CID 177369571
(2S)-2-(3,3-diethylpyrrolidin-1-yl)-3-ethylpentanamide (PubChem CID 177369571) has the molecular formula C15H30N2O and a molecular weight of 254.42 g/mol. Its IUPAC name is (2S)-2-(3,3-diethylpyrrolidin-1-yl)-3-ethylpentanamide.
| Compound Name | (2S)-2-(3,3-diethylpyrrolidin-1-yl)-3-ethylpentanamide |
|---|---|
| PubChem CID | 177369571 |
| Molecular Formula | C15H30N2O |
| Molecular Weight | 254.42 g/mol |
| Exact Mass | 254.24 |
| IUPAC Name | (2S)-2-(3,3-diethylpyrrolidin-1-yl)-3-ethylpentanamide |
| SMILES | CCC(CC)[C@@H](C(N)=O)N1CCC(CC)(CC)C1 |
| InChI | InChI=1S/C15H30N2O/c1-5-12(6-2)13(14(16)18)17-10-9-15(7-3,8-4)11-17/h12-13H,5-11H2,1-4H3,(H2,16,18)/t13-/m0/s1 |
| InChIKey | AMQBLQXWWOHQOC-ZDUSSCGKSA-N |
| XLogP | 2.79 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.42 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |