C25H25N5O4 — CID 177372076
methyl 4-[4-[4-[4-[(2,4-dioxopyrimidin-1-yl)methyl]phenyl]triazol-1-yl]butyl]benzoate (PubChem CID 177372076) has the molecular formula C25H25N5O4 and a molecular weight of 459.51 g/mol. Its IUPAC name is methyl 4-[4-[4-[4-[(2,4-dioxopyrimidin-1-yl)methyl]phenyl]triazol-1-yl]butyl]benzoate.
| Compound Name | methyl 4-[4-[4-[4-[(2,4-dioxopyrimidin-1-yl)methyl]phenyl]triazol-1-yl]butyl]benzoate |
|---|---|
| PubChem CID | 177372076 |
| Molecular Formula | C25H25N5O4 |
| Molecular Weight | 459.51 g/mol |
| Exact Mass | 459.19 |
| IUPAC Name | methyl 4-[4-[4-[4-[(2,4-dioxopyrimidin-1-yl)methyl]phenyl]triazol-1-yl]butyl]benzoate |
| SMILES | COC(=O)c1ccc(CCCCn2cc(-c3ccc(Cn4ccc(=O)[nH]c4=O)cc3)nn2)cc1 |
| InChI | InChI=1S/C25H25N5O4/c1-34-24(32)21-11-5-18(6-12-21)4-2-3-14-30-17-22(27-28-30)20-9-7-19(8-10-20)16-29-15-13-23(31)26-25(29)33/h5-13,15,17H,2-4,14,16H2,1H3,(H,26,31,33) |
| InChIKey | HKZIOKWWAXBCCU-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 111.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.51 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|