C25H34F3N9O6 — CID 177376323
N-[5-(hydroxyamino)-5-oxopentyl]-2-[4-[3-[(2S)-2-[[6-oxo-5-(trifluoromethyl)-1H-pyridazin-4-yl]amino]propoxy]propanoyl]piperazin-1-yl]pyrimidine-5-carboxamide (PubChem CID 177376323) has the molecular formula C25H34F3N9O6 and a molecular weight of 613.60 g/mol. Its IUPAC name is N-[5-(hydroxyamino)-5-oxopentyl]-2-[4-[3-[(2S)-2-[[6-oxo-5-(trifluoromethyl)-1H-pyridazin-4-yl]amino]propoxy]propanoyl]piperazin-1-yl]pyrimidine-5-carboxamide.
| Compound Name | N-[5-(hydroxyamino)-5-oxopentyl]-2-[4-[3-[(2S)-2-[[6-oxo-5-(trifluoromethyl)-1H-pyridazin-4-yl]amino]propoxy]propanoyl]piperazin-1-yl]pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 177376323 |
| Molecular Formula | C25H34F3N9O6 |
| Molecular Weight | 613.60 g/mol |
| Exact Mass | 613.26 |
| IUPAC Name | N-[5-(hydroxyamino)-5-oxopentyl]-2-[4-[3-[(2S)-2-[[6-oxo-5-(trifluoromethyl)-1H-pyridazin-4-yl]amino]propoxy]propanoyl]piperazin-1-yl]pyrimidine-5-carboxamide |
| SMILES | C[C@@H](COCCC(=O)N1CCN(c2ncc(C(=O)NCCCCC(=O)NO)cn2)CC1)Nc1cn[nH]c(=O)c1C(F)(F)F |
| InChI | InChI=1S/C25H34F3N9O6/c1-16(33-18-14-32-34-23(41)21(18)25(26,27)28)15-43-11-5-20(39)36-7-9-37(10-8-36)24-30-12-17(13-31-24)22(40)29-6-3-2-4-19(38)35-42/h12-14,16,42H,2-11,15H2,1H3,(H,29,40)(H,35,38)(H2,33,34,41)/t16-/m0/s1 |
| InChIKey | JYGANUXFIOAQPJ-INIZCTEOSA-N |
| XLogP | 0.54 |
| TPSA | 194.77 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.60 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|