C20H26N4O5 — CID 177377681
N-[7-(hydroxyamino)-7-oxoheptyl]-4-[(Z)-(1-methyl-3,6-dioxopiperazin-2-ylidene)methyl]benzamide (PubChem CID 177377681) has the molecular formula C20H26N4O5 and a molecular weight of 402.45 g/mol. Its IUPAC name is N-[7-(hydroxyamino)-7-oxoheptyl]-4-[(Z)-(1-methyl-3,6-dioxopiperazin-2-ylidene)methyl]benzamide.
| Compound Name | N-[7-(hydroxyamino)-7-oxoheptyl]-4-[(Z)-(1-methyl-3,6-dioxopiperazin-2-ylidene)methyl]benzamide |
|---|---|
| PubChem CID | 177377681 |
| Molecular Formula | C20H26N4O5 |
| Molecular Weight | 402.45 g/mol |
| Exact Mass | 402.19 |
| IUPAC Name | N-[7-(hydroxyamino)-7-oxoheptyl]-4-[(Z)-(1-methyl-3,6-dioxopiperazin-2-ylidene)methyl]benzamide |
| SMILES | CN1C(=O)CNC(=O)/C1=C/c1ccc(C(=O)NCCCCCCC(=O)NO)cc1 |
| InChI | InChI=1S/C20H26N4O5/c1-24-16(20(28)22-13-18(24)26)12-14-7-9-15(10-8-14)19(27)21-11-5-3-2-4-6-17(25)23-29/h7-10,12,29H,2-6,11,13H2,1H3,(H,21,27)(H,22,28)(H,23,25)/b16-12- |
| InChIKey | OMWKLIAWIVALKF-VBKFSLOCSA-N |
| XLogP | 0.80 |
| TPSA | 127.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.45 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|