C16H18N4O5 — CID 177377682
N-[3-(hydroxyamino)-3-oxopropyl]-4-[(Z)-(1-methyl-3,6-dioxopiperazin-2-ylidene)methyl]benzamide (PubChem CID 177377682) has the molecular formula C16H18N4O5 and a molecular weight of 346.34 g/mol. Its IUPAC name is N-[3-(hydroxyamino)-3-oxopropyl]-4-[(Z)-(1-methyl-3,6-dioxopiperazin-2-ylidene)methyl]benzamide.
| Compound Name | N-[3-(hydroxyamino)-3-oxopropyl]-4-[(Z)-(1-methyl-3,6-dioxopiperazin-2-ylidene)methyl]benzamide |
|---|---|
| PubChem CID | 177377682 |
| Molecular Formula | C16H18N4O5 |
| Molecular Weight | 346.34 g/mol |
| Exact Mass | 346.13 |
| IUPAC Name | N-[3-(hydroxyamino)-3-oxopropyl]-4-[(Z)-(1-methyl-3,6-dioxopiperazin-2-ylidene)methyl]benzamide |
| SMILES | CN1C(=O)CNC(=O)/C1=C/c1ccc(C(=O)NCCC(=O)NO)cc1 |
| InChI | InChI=1S/C16H18N4O5/c1-20-12(16(24)18-9-14(20)22)8-10-2-4-11(5-3-10)15(23)17-7-6-13(21)19-25/h2-5,8,25H,6-7,9H2,1H3,(H,17,23)(H,18,24)(H,19,21)/b12-8- |
| InChIKey | RSNIBRDBUZUEQC-WQLSENKSSA-N |
| XLogP | -0.76 |
| TPSA | 127.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.34 |
| LogP ≤ 5 | -0.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|