C30H39N5O3 — CID 177378449
benzyl N-[(5S)-5-amino-6-oxo-6-[3-(1,2,3,4-tetrahydroacridin-9-ylamino)propylamino]hexyl]carbamate (PubChem CID 177378449) has the molecular formula C30H39N5O3 and a molecular weight of 517.67 g/mol. Its IUPAC name is benzyl N-[(5S)-5-amino-6-oxo-6-[3-(1,2,3,4-tetrahydroacridin-9-ylamino)propylamino]hexyl]carbamate.
| Compound Name | benzyl N-[(5S)-5-amino-6-oxo-6-[3-(1,2,3,4-tetrahydroacridin-9-ylamino)propylamino]hexyl]carbamate |
|---|---|
| PubChem CID | 177378449 |
| Molecular Formula | C30H39N5O3 |
| Molecular Weight | 517.67 g/mol |
| Exact Mass | 517.31 |
| IUPAC Name | benzyl N-[(5S)-5-amino-6-oxo-6-[3-(1,2,3,4-tetrahydroacridin-9-ylamino)propylamino]hexyl]carbamate |
| SMILES | N[C@@H](CCCCNC(=O)OCc1ccccc1)C(=O)NCCCNc1c2c(nc3ccccc13)CCCC2 |
| InChI | InChI=1S/C30H39N5O3/c31-25(15-8-9-18-34-30(37)38-21-22-11-2-1-3-12-22)29(36)33-20-10-19-32-28-23-13-4-6-16-26(23)35-27-17-7-5-14-24(27)28/h1-4,6,11-13,16,25H,5,7-10,14-15,17-21,31H2,(H,32,35)(H,33,36)(H,34,37)/t25-/m0/s1 |
| InChIKey | WKPBEHBVALMEDG-VWLOTQADSA-N |
| XLogP | 4.46 |
| TPSA | 118.37 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.67 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|