C19H16F3N5O3 — CID 177378649
methyl 4-oxo-4-[4-(2H-tetrazol-5-yl)anilino]-2-[4-(trifluoromethyl)phenyl]butanoate (PubChem CID 177378649) has the molecular formula C19H16F3N5O3 and a molecular weight of 419.36 g/mol. Its IUPAC name is methyl 4-oxo-4-[4-(2H-tetrazol-5-yl)anilino]-2-[4-(trifluoromethyl)phenyl]butanoate.
| Compound Name | methyl 4-oxo-4-[4-(2H-tetrazol-5-yl)anilino]-2-[4-(trifluoromethyl)phenyl]butanoate |
|---|---|
| PubChem CID | 177378649 |
| Molecular Formula | C19H16F3N5O3 |
| Molecular Weight | 419.36 g/mol |
| Exact Mass | 419.12 |
| IUPAC Name | methyl 4-oxo-4-[4-(2H-tetrazol-5-yl)anilino]-2-[4-(trifluoromethyl)phenyl]butanoate |
| SMILES | COC(=O)C(CC(=O)Nc1ccc(-c2nn[nH]n2)cc1)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C19H16F3N5O3/c1-30-18(29)15(11-2-6-13(7-3-11)19(20,21)22)10-16(28)23-14-8-4-12(5-9-14)17-24-26-27-25-17/h2-9,15H,10H2,1H3,(H,23,28)(H,24,25,26,27) |
| InChIKey | OYMZISHHOFXQQY-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 109.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.36 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |