C13H14N2O5S — CID 177378743
ethyl 2-[2,4,5-trioxo-3-(2-thiophen-2-ylethyl)imidazolidin-1-yl]acetate (PubChem CID 177378743) has the molecular formula C13H14N2O5S and a molecular weight of 310.33 g/mol. Its IUPAC name is ethyl 2-[2,4,5-trioxo-3-(2-thiophen-2-ylethyl)imidazolidin-1-yl]acetate.
| Compound Name | ethyl 2-[2,4,5-trioxo-3-(2-thiophen-2-ylethyl)imidazolidin-1-yl]acetate |
|---|---|
| PubChem CID | 177378743 |
| Molecular Formula | C13H14N2O5S |
| Molecular Weight | 310.33 g/mol |
| Exact Mass | 310.06 |
| IUPAC Name | ethyl 2-[2,4,5-trioxo-3-(2-thiophen-2-ylethyl)imidazolidin-1-yl]acetate |
| SMILES | CCOC(=O)CN1C(=O)C(=O)N(CCc2cccs2)C1=O |
| InChI | InChI=1S/C13H14N2O5S/c1-2-20-10(16)8-15-12(18)11(17)14(13(15)19)6-5-9-4-3-7-21-9/h3-4,7H,2,5-6,8H2,1H3 |
| InChIKey | YNTRBHWBILKYST-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 83.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.33 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|