C13H14N2O3S — CID 123728499
ethyl 2-[(4Z)-2-methylidene-5-oxo-4-(thiophen-2-ylmethylidene)imidazolidin-1-yl]acetate (PubChem CID 123728499) has the molecular formula C13H14N2O3S and a molecular weight of 278.33 g/mol. Its IUPAC name is ethyl 2-[(4Z)-2-methylidene-5-oxo-4-(thiophen-2-ylmethylidene)imidazolidin-1-yl]acetate.
| Compound Name | ethyl 2-[(4Z)-2-methylidene-5-oxo-4-(thiophen-2-ylmethylidene)imidazolidin-1-yl]acetate |
|---|---|
| PubChem CID | 123728499 |
| Molecular Formula | C13H14N2O3S |
| Molecular Weight | 278.33 g/mol |
| Exact Mass | 278.07 |
| IUPAC Name | ethyl 2-[(4Z)-2-methylidene-5-oxo-4-(thiophen-2-ylmethylidene)imidazolidin-1-yl]acetate |
| SMILES | C=c1[nH]/c(=C\c2cccs2)c(=O)n1CC(=O)OCC |
| InChI | InChI=1S/C13H14N2O3S/c1-3-18-12(16)8-15-9(2)14-11(13(15)17)7-10-5-4-6-19-10/h4-7,14H,2-3,8H2,1H3/b11-7- |
| InChIKey | KKXSVARQCMKPCH-XFFZJAGNSA-N |
| XLogP | 0.04 |
| TPSA | 64.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.33 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |