C12H14N2OS2 — CID 5400801
(5Z)-5-[(5-methylthiophen-2-yl)methylidene]-3-propyl-2-sulfanylideneimidazolidin-4-one (PubChem CID 5400801) has the molecular formula C12H14N2OS2 and a molecular weight of 266.39 g/mol. Its IUPAC name is (5Z)-5-[(5-methylthiophen-2-yl)methylidene]-3-propyl-2-sulfanylideneimidazolidin-4-one.
| Compound Name | (5Z)-5-[(5-methylthiophen-2-yl)methylidene]-3-propyl-2-sulfanylideneimidazolidin-4-one |
|---|---|
| PubChem CID | 5400801 |
| Molecular Formula | C12H14N2OS2 |
| Molecular Weight | 266.39 g/mol |
| Exact Mass | 266.05 |
| IUPAC Name | (5Z)-5-[(5-methylthiophen-2-yl)methylidene]-3-propyl-2-sulfanylideneimidazolidin-4-one |
| SMILES | CCCN1C(=O)/C(=C/c2ccc(C)s2)NC1=S |
| InChI | InChI=1S/C12H14N2OS2/c1-3-6-14-11(15)10(13-12(14)16)7-9-5-4-8(2)17-9/h4-5,7H,3,6H2,1-2H3,(H,13,16)/b10-7- |
| InChIKey | WUXDGPZEFQXYAM-YFHOEESVSA-N |
| XLogP | 2.52 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.39 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|