C14H16BrN3OS2 — CID 5468930
(5Z)-5-[(5-bromothiophen-2-yl)methylidene]-3-(piperidin-1-ylmethyl)-2-sulfanylideneimidazolidin-4-one (PubChem CID 5468930) has the molecular formula C14H16BrN3OS2 and a molecular weight of 386.34 g/mol. Its IUPAC name is (5Z)-5-[(5-bromothiophen-2-yl)methylidene]-3-(piperidin-1-ylmethyl)-2-sulfanylideneimidazolidin-4-one.
| Compound Name | (5Z)-5-[(5-bromothiophen-2-yl)methylidene]-3-(piperidin-1-ylmethyl)-2-sulfanylideneimidazolidin-4-one |
|---|---|
| PubChem CID | 5468930 |
| Molecular Formula | C14H16BrN3OS2 |
| Molecular Weight | 386.34 g/mol |
| Exact Mass | 384.99 |
| IUPAC Name | (5Z)-5-[(5-bromothiophen-2-yl)methylidene]-3-(piperidin-1-ylmethyl)-2-sulfanylideneimidazolidin-4-one |
| SMILES | O=C1/C(=C/c2ccc(Br)s2)NC(=S)N1CN1CCCCC1 |
| InChI | InChI=1S/C14H16BrN3OS2/c15-12-5-4-10(21-12)8-11-13(19)18(14(20)16-11)9-17-6-2-1-3-7-17/h4-5,8H,1-3,6-7,9H2,(H,16,20)/b11-8- |
| InChIKey | HDMXDTZBZUFELG-FLIBITNWSA-N |
| XLogP | 3.01 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.34 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|