C8H6N2OS2 — CID 5469195
(5Z)-2-sulfanylidene-5-(thiophen-2-ylmethylidene)imidazolidin-4-one (PubChem CID 5469195) has the molecular formula C8H6N2OS2 and a molecular weight of 210.28 g/mol. Its IUPAC name is (5Z)-2-sulfanylidene-5-(thiophen-2-ylmethylidene)imidazolidin-4-one.
| Compound Name | (5Z)-2-sulfanylidene-5-(thiophen-2-ylmethylidene)imidazolidin-4-one |
|---|---|
| PubChem CID | 5469195 |
| Molecular Formula | C8H6N2OS2 |
| Molecular Weight | 210.28 g/mol |
| Exact Mass | 209.99 |
| IUPAC Name | (5Z)-2-sulfanylidene-5-(thiophen-2-ylmethylidene)imidazolidin-4-one |
| SMILES | O=C1NC(=S)N/C1=C\c1cccs1 |
| InChI | InChI=1S/C8H6N2OS2/c11-7-6(9-8(12)10-7)4-5-2-1-3-13-5/h1-4H,(H2,9,10,11,12)/b6-4- |
| InChIKey | BHMMWVDJRGROOU-XQRVVYSFSA-N |
| XLogP | 1.09 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.28 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|