C28H24N4O4 — CID 177379342
N-hydroxy-4-[[(1S)-14-methyl-13,15-dioxo-1-phenyl-9,12,14-triazatetracyclo[10.3.1.02,10.03,8]hexadeca-2(10),3,5,7-tetraen-9-yl]methyl]benzamide (PubChem CID 177379342) has the molecular formula C28H24N4O4 and a molecular weight of 480.52 g/mol. Its IUPAC name is N-hydroxy-4-[[(1S)-14-methyl-13,15-dioxo-1-phenyl-9,12,14-triazatetracyclo[10.3.1.02,10.03,8]hexadeca-2(10),3,5,7-tetraen-9-yl]methyl]benzamide.
| Compound Name | N-hydroxy-4-[[(1S)-14-methyl-13,15-dioxo-1-phenyl-9,12,14-triazatetracyclo[10.3.1.02,10.03,8]hexadeca-2(10),3,5,7-tetraen-9-yl]methyl]benzamide |
|---|---|
| PubChem CID | 177379342 |
| Molecular Formula | C28H24N4O4 |
| Molecular Weight | 480.52 g/mol |
| Exact Mass | 480.18 |
| IUPAC Name | N-hydroxy-4-[[(1S)-14-methyl-13,15-dioxo-1-phenyl-9,12,14-triazatetracyclo[10.3.1.02,10.03,8]hexadeca-2(10),3,5,7-tetraen-9-yl]methyl]benzamide |
| SMILES | CN1C(=O)N2Cc3c(c4ccccc4n3Cc3ccc(C(=O)NO)cc3)[C@@](c3ccccc3)(C2)C1=O |
| InChI | InChI=1S/C28H24N4O4/c1-30-26(34)28(20-7-3-2-4-8-20)17-31(27(30)35)16-23-24(28)21-9-5-6-10-22(21)32(23)15-18-11-13-19(14-12-18)25(33)29-36/h2-14,36H,15-17H2,1H3,(H,29,33)/t28-/m0/s1 |
| InChIKey | IRKQLOCVTRWOQK-NDEPHWFRSA-N |
| XLogP | 3.50 |
| TPSA | 94.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.52 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|