C18H17F3O3 — CID 177379479
2-[4-[4-propan-2-yloxy-3-(trifluoromethyl)phenyl]phenyl]acetic acid (PubChem CID 177379479) has the molecular formula C18H17F3O3 and a molecular weight of 338.33 g/mol. Its IUPAC name is 2-[4-[4-propan-2-yloxy-3-(trifluoromethyl)phenyl]phenyl]acetic acid.
| Compound Name | 2-[4-[4-propan-2-yloxy-3-(trifluoromethyl)phenyl]phenyl]acetic acid |
|---|---|
| PubChem CID | 177379479 |
| Molecular Formula | C18H17F3O3 |
| Molecular Weight | 338.33 g/mol |
| Exact Mass | 338.11 |
| IUPAC Name | 2-[4-[4-propan-2-yloxy-3-(trifluoromethyl)phenyl]phenyl]acetic acid |
| SMILES | CC(C)Oc1ccc(-c2ccc(CC(=O)O)cc2)cc1C(F)(F)F |
| InChI | InChI=1S/C18H17F3O3/c1-11(2)24-16-8-7-14(10-15(16)18(19,20)21)13-5-3-12(4-6-13)9-17(22)23/h3-8,10-11H,9H2,1-2H3,(H,22,23) |
| InChIKey | WKIUMYIPRMAXGV-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.33 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |