C25H22N4OS — CID 177380423
(E)-N-(2-aminophenyl)-3-[4-[5-(anilinomethyl)-1,3-thiazol-2-yl]phenyl]prop-2-enamide (PubChem CID 177380423) has the molecular formula C25H22N4OS and a molecular weight of 426.55 g/mol. Its IUPAC name is (E)-N-(2-aminophenyl)-3-[4-[5-(anilinomethyl)-1,3-thiazol-2-yl]phenyl]prop-2-enamide.
| Compound Name | (E)-N-(2-aminophenyl)-3-[4-[5-(anilinomethyl)-1,3-thiazol-2-yl]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 177380423 |
| Molecular Formula | C25H22N4OS |
| Molecular Weight | 426.55 g/mol |
| Exact Mass | 426.15 |
| IUPAC Name | (E)-N-(2-aminophenyl)-3-[4-[5-(anilinomethyl)-1,3-thiazol-2-yl]phenyl]prop-2-enamide |
| SMILES | Nc1ccccc1NC(=O)/C=C/c1ccc(-c2ncc(CNc3ccccc3)s2)cc1 |
| InChI | InChI=1S/C25H22N4OS/c26-22-8-4-5-9-23(22)29-24(30)15-12-18-10-13-19(14-11-18)25-28-17-21(31-25)16-27-20-6-2-1-3-7-20/h1-15,17,27H,16,26H2,(H,29,30)/b15-12+ |
| InChIKey | QSCNEPJIZHYDFO-NTCAYCPXSA-N |
| XLogP | 5.66 |
| TPSA | 80.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.55 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|