C20H15ClN2O2S — CID 177381262
5-[3-[(2-chloroanilino)methyl]indol-1-yl]thiophene-2-carboxylic acid (PubChem CID 177381262) has the molecular formula C20H15ClN2O2S and a molecular weight of 382.87 g/mol. Its IUPAC name is 5-[3-[(2-chloroanilino)methyl]indol-1-yl]thiophene-2-carboxylic acid.
| Compound Name | 5-[3-[(2-chloroanilino)methyl]indol-1-yl]thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 177381262 |
| Molecular Formula | C20H15ClN2O2S |
| Molecular Weight | 382.87 g/mol |
| Exact Mass | 382.05 |
| IUPAC Name | 5-[3-[(2-chloroanilino)methyl]indol-1-yl]thiophene-2-carboxylic acid |
| SMILES | O=C(O)c1ccc(-n2cc(CNc3ccccc3Cl)c3ccccc32)s1 |
| InChI | InChI=1S/C20H15ClN2O2S/c21-15-6-2-3-7-16(15)22-11-13-12-23(17-8-4-1-5-14(13)17)19-10-9-18(26-19)20(24)25/h1-10,12,22H,11H2,(H,24,25) |
| InChIKey | BBYNZVFTDPYKEI-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 54.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.87 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |