C22H26N5OPS — CID 177381348
4-(7-dimethylphosphoryl-1H-indol-3-yl)-6-methyl-N-[(3S)-piperidin-3-yl]thieno[3,2-d]pyrimidin-2-amine (PubChem CID 177381348) has the molecular formula C22H26N5OPS and a molecular weight of 439.53 g/mol. Its IUPAC name is 4-(7-dimethylphosphoryl-1H-indol-3-yl)-6-methyl-N-[(3S)-piperidin-3-yl]thieno[3,2-d]pyrimidin-2-amine.
| Compound Name | 4-(7-dimethylphosphoryl-1H-indol-3-yl)-6-methyl-N-[(3S)-piperidin-3-yl]thieno[3,2-d]pyrimidin-2-amine |
|---|---|
| PubChem CID | 177381348 |
| Molecular Formula | C22H26N5OPS |
| Molecular Weight | 439.53 g/mol |
| Exact Mass | 439.16 |
| IUPAC Name | 4-(7-dimethylphosphoryl-1H-indol-3-yl)-6-methyl-N-[(3S)-piperidin-3-yl]thieno[3,2-d]pyrimidin-2-amine |
| SMILES | Cc1cc2nc(N[C@H]3CCCNC3)nc(-c3c[nH]c4c(P(C)(C)=O)cccc34)c2s1 |
| InChI | InChI=1S/C22H26N5OPS/c1-13-10-17-21(30-13)20(27-22(26-17)25-14-6-5-9-23-11-14)16-12-24-19-15(16)7-4-8-18(19)29(2,3)28/h4,7-8,10,12,14,23-24H,5-6,9,11H2,1-3H3,(H,25,26,27)/t14-/m0/s1 |
| InChIKey | JCLKCMQLQWRZNM-AWEZNQCLSA-N |
| XLogP | 4.56 |
| TPSA | 82.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.53 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|