C21H24N5OPS — CID 177381350
4-(7-dimethylphosphoryl-1H-indol-3-yl)-N-[(3S,5R)-5-methylpyrrolidin-3-yl]thieno[3,2-d]pyrimidin-2-amine (PubChem CID 177381350) has the molecular formula C21H24N5OPS and a molecular weight of 425.50 g/mol. Its IUPAC name is 4-(7-dimethylphosphoryl-1H-indol-3-yl)-N-[(3S,5R)-5-methylpyrrolidin-3-yl]thieno[3,2-d]pyrimidin-2-amine.
| Compound Name | 4-(7-dimethylphosphoryl-1H-indol-3-yl)-N-[(3S,5R)-5-methylpyrrolidin-3-yl]thieno[3,2-d]pyrimidin-2-amine |
|---|---|
| PubChem CID | 177381350 |
| Molecular Formula | C21H24N5OPS |
| Molecular Weight | 425.50 g/mol |
| Exact Mass | 425.14 |
| IUPAC Name | 4-(7-dimethylphosphoryl-1H-indol-3-yl)-N-[(3S,5R)-5-methylpyrrolidin-3-yl]thieno[3,2-d]pyrimidin-2-amine |
| SMILES | C[C@@H]1C[C@H](Nc2nc(-c3c[nH]c4c(P(C)(C)=O)cccc34)c3sccc3n2)CN1 |
| InChI | InChI=1S/C21H24N5OPS/c1-12-9-13(10-22-12)24-21-25-16-7-8-29-20(16)19(26-21)15-11-23-18-14(15)5-4-6-17(18)28(2,3)27/h4-8,11-13,22-23H,9-10H2,1-3H3,(H,24,25,26)/t12-,13+/m1/s1 |
| InChIKey | OLRSTHYDWBSQFT-OLZOCXBDSA-N |
| XLogP | 4.25 |
| TPSA | 82.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.50 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|