C29H25N3O6S — CID 177381506
3-amino-4-(3,4-dihydroxyphenyl)-6-(3,4-dimethoxyphenyl)-N-(4-methoxyphenyl)thieno[2,3-b]pyridine-2-carboxamide (PubChem CID 177381506) has the molecular formula C29H25N3O6S and a molecular weight of 543.60 g/mol. Its IUPAC name is 3-amino-4-(3,4-dihydroxyphenyl)-6-(3,4-dimethoxyphenyl)-N-(4-methoxyphenyl)thieno[2,3-b]pyridine-2-carboxamide.
| Compound Name | 3-amino-4-(3,4-dihydroxyphenyl)-6-(3,4-dimethoxyphenyl)-N-(4-methoxyphenyl)thieno[2,3-b]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 177381506 |
| Molecular Formula | C29H25N3O6S |
| Molecular Weight | 543.60 g/mol |
| Exact Mass | 543.15 |
| IUPAC Name | 3-amino-4-(3,4-dihydroxyphenyl)-6-(3,4-dimethoxyphenyl)-N-(4-methoxyphenyl)thieno[2,3-b]pyridine-2-carboxamide |
| SMILES | COc1ccc(NC(=O)c2sc3nc(-c4ccc(OC)c(OC)c4)cc(-c4ccc(O)c(O)c4)c3c2N)cc1 |
| InChI | InChI=1S/C29H25N3O6S/c1-36-18-8-6-17(7-9-18)31-28(35)27-26(30)25-19(15-4-10-21(33)22(34)12-15)14-20(32-29(25)39-27)16-5-11-23(37-2)24(13-16)38-3/h4-14,33-34H,30H2,1-3H3,(H,31,35) |
| InChIKey | VAJLFKLQMSBMBP-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 136.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.60 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|