C24H24 — CID 177383575
(7Z,8E)-7,8-bis(1-phenylethylidene)bicyclo[4.2.0]oct-1(6)-ene (PubChem CID 177383575) has the molecular formula C24H24 and a molecular weight of 312.46 g/mol. Its IUPAC name is (7Z,8E)-7,8-bis(1-phenylethylidene)bicyclo[4.2.0]oct-1(6)-ene.
| Compound Name | (7Z,8E)-7,8-bis(1-phenylethylidene)bicyclo[4.2.0]oct-1(6)-ene |
|---|---|
| PubChem CID | 177383575 |
| Molecular Formula | C24H24 |
| Molecular Weight | 312.46 g/mol |
| Exact Mass | 312.19 |
| IUPAC Name | (7Z,8E)-7,8-bis(1-phenylethylidene)bicyclo[4.2.0]oct-1(6)-ene |
| SMILES | C/C(=C1\C2=C(CCCC2)\C1=C(\C)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C24H24/c1-17(19-11-5-3-6-12-19)23-21-15-9-10-16-22(21)24(23)18(2)20-13-7-4-8-14-20/h3-8,11-14H,9-10,15-16H2,1-2H3/b23-17-,24-18+ |
| InChIKey | JSFNWHDICVGVGG-QFFDILLMSA-N |
| XLogP | 6.82 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.46 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |