About [(E)-3,6-dichloro-6-cyclohexylidenehex-2-en-4-yn-2-yl]benzene
[(E)-3,6-dichloro-6-cyclohexylidenehex-2-en-4-yn-2-yl]benzene (PubChem CID 71697418) has the molecular formula C18H18Cl2
and a molecular weight of 305.25 g/mol. Its IUPAC name is [(E)-3,6-dichloro-6-cyclohexylidenehex-2-en-4-yn-2-yl]benzene.
Molecular Properties
| Compound Name | [(E)-3,6-dichloro-6-cyclohexylidenehex-2-en-4-yn-2-yl]benzene |
| PubChem CID | 71697418 |
| Molecular Formula | C18H18Cl2 |
| Molecular Weight | 305.25 g/mol |
| Exact Mass | 304.08 |
| IUPAC Name | [(E)-3,6-dichloro-6-cyclohexylidenehex-2-en-4-yn-2-yl]benzene |
| SMILES | C/C(=C(\Cl)C#CC(Cl)=C1CCCCC1)c1ccccc1 |
| InChI | InChI=1S/C18H18Cl2/c1-14(15-8-4-2-5-9-15)17(19)12-13-18(20)16-10-6-3-7-11-16/h2,4-5,8-9H,3,6-7,10-11H2,1H3/b17-14+ |
| InChIKey | HFDLCBLBMASCSD-SAPNQHFASA-N |
| XLogP | 6.12 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 305.25 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze [(E)-3,6-dichloro-6-cyclohexylidenehex-2-en-4-yn-2-yl]benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(E)-3,6-dichloro-6-cyclohexylidenehex-2-en-4-yn-2-yl]benzene?
The IUPAC name of [(E)-3,6-dichloro-6-cyclohexylidenehex-2-en-4-yn-2-yl]benzene (CID 71697418) is [(E)-3,6-dichloro-6-cyclohexylidenehex-2-en-4-yn-2-yl]benzene.
What is the SMILES notation for [(E)-3,6-dichloro-6-cyclohexylidenehex-2-en-4-yn-2-yl]benzene?
The canonical SMILES for [(E)-3,6-dichloro-6-cyclohexylidenehex-2-en-4-yn-2-yl]benzene is C/C(=C(\Cl)C#CC(Cl)=C1CCCCC1)c1ccccc1.
What is the InChIKey of [(E)-3,6-dichloro-6-cyclohexylidenehex-2-en-4-yn-2-yl]benzene?
The InChIKey is HFDLCBLBMASCSD-SAPNQHFASA-N. The full InChI is InChI=1S/C18H18Cl2/c1-14(15-8-4-2-5-9-15)17(19)12-13-18(20)16-10-6-3-7-11-16/h2,4-5,8-9H,3,6-7,10-11H2,1H3/b17-14+.
What are the key properties of [(E)-3,6-dichloro-6-cyclohexylidenehex-2-en-4-yn-2-yl]benzene?
[(E)-3,6-dichloro-6-cyclohexylidenehex-2-en-4-yn-2-yl]benzene has a molecular weight of 305.25 g/mol, XLogP of 6.12, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for [(E)-3,6-dichloro-6-cyclohexylidenehex-2-en-4-yn-2-yl]benzene is sourced from PubChem (CID 71697418), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).