C25H26O5 — CID 177385306
(1E,11E,14S)-2-hydroxy-11,15-dimethyl-14-(3-methylbut-2-enyl)-17,18-dioxo-9-oxatricyclo[12.3.1.03,8]octadeca-1,3,5,7,11,15-hexaene-4-carbaldehyde (PubChem CID 177385306) has the molecular formula C25H26O5 and a molecular weight of 406.48 g/mol. Its IUPAC name is (1E,11E,14S)-2-hydroxy-11,15-dimethyl-14-(3-methylbut-2-enyl)-17,18-dioxo-9-oxatricyclo[12.3.1.03,8]octadeca-1,3,5,7,11,15-hexaene-4-carbaldehyde.
| Compound Name | (1E,11E,14S)-2-hydroxy-11,15-dimethyl-14-(3-methylbut-2-enyl)-17,18-dioxo-9-oxatricyclo[12.3.1.03,8]octadeca-1,3,5,7,11,15-hexaene-4-carbaldehyde |
|---|---|
| PubChem CID | 177385306 |
| Molecular Formula | C25H26O5 |
| Molecular Weight | 406.48 g/mol |
| Exact Mass | 406.18 |
| IUPAC Name | (1E,11E,14S)-2-hydroxy-11,15-dimethyl-14-(3-methylbut-2-enyl)-17,18-dioxo-9-oxatricyclo[12.3.1.03,8]octadeca-1,3,5,7,11,15-hexaene-4-carbaldehyde |
| SMILES | CC(C)=CC[C@]12C/C=C(/C)COc3cccc(C=O)c3/C(O)=C(\C(=O)C=C1C)C2=O |
| InChI | InChI=1S/C25H26O5/c1-15(2)8-10-25-11-9-16(3)14-30-20-7-5-6-18(13-26)21(20)23(28)22(24(25)29)19(27)12-17(25)4/h5-9,12-13,28H,10-11,14H2,1-4H3/b16-9-,23-22-/t25-/m0/s1 |
| InChIKey | QUJTZZOLLMVPJC-YAZAKJDXSA-N |
| XLogP | 4.94 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.48 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|