C19H15NS — CID 177385434
(Z)-3-(2,5-dimethylthiophen-3-yl)-2-naphthalen-2-ylprop-2-enenitrile (PubChem CID 177385434) has the molecular formula C19H15NS and a molecular weight of 289.40 g/mol. Its IUPAC name is (Z)-3-(2,5-dimethylthiophen-3-yl)-2-naphthalen-2-ylprop-2-enenitrile.
| Compound Name | (Z)-3-(2,5-dimethylthiophen-3-yl)-2-naphthalen-2-ylprop-2-enenitrile |
|---|---|
| PubChem CID | 177385434 |
| Molecular Formula | C19H15NS |
| Molecular Weight | 289.40 g/mol |
| Exact Mass | 289.09 |
| IUPAC Name | (Z)-3-(2,5-dimethylthiophen-3-yl)-2-naphthalen-2-ylprop-2-enenitrile |
| SMILES | Cc1cc(/C=C(\C#N)c2ccc3ccccc3c2)c(C)s1 |
| InChI | InChI=1S/C19H15NS/c1-13-9-18(14(2)21-13)11-19(12-20)17-8-7-15-5-3-4-6-16(15)10-17/h3-11H,1-2H3/b19-11+ |
| InChIKey | KGZMRIGGNBPYFQ-YBFXNURJSA-N |
| XLogP | 5.58 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.40 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|