About (Z)-3-(2,5-dimethylthiophen-3-yl)-2-naphthalen-2-ylprop-2-enenitrile
(Z)-3-(2,5-dimethylthiophen-3-yl)-2-naphthalen-2-ylprop-2-enenitrile (PubChem CID 177385434) has the molecular formula C19H15NS
and a molecular weight of 289.40 g/mol. Its IUPAC name is (Z)-3-(2,5-dimethylthiophen-3-yl)-2-naphthalen-2-ylprop-2-enenitrile.
Molecular Properties
| Compound Name | (Z)-3-(2,5-dimethylthiophen-3-yl)-2-naphthalen-2-ylprop-2-enenitrile |
| PubChem CID | 177385434 |
| Molecular Formula | C19H15NS |
| Molecular Weight | 289.40 g/mol |
| Exact Mass | 289.09 |
| IUPAC Name | (Z)-3-(2,5-dimethylthiophen-3-yl)-2-naphthalen-2-ylprop-2-enenitrile |
| SMILES | Cc1cc(/C=C(\C#N)c2ccc3ccccc3c2)c(C)s1 |
| InChI | InChI=1S/C19H15NS/c1-13-9-18(14(2)21-13)11-19(12-20)17-8-7-15-5-3-4-6-16(15)10-17/h3-11H,1-2H3/b19-11+ |
| InChIKey | KGZMRIGGNBPYFQ-YBFXNURJSA-N |
| XLogP | 5.58 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 289.40 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|
Analyze (Z)-3-(2,5-dimethylthiophen-3-yl)-2-naphthalen-2-ylprop-2-enenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-3-(2,5-dimethylthiophen-3-yl)-2-naphthalen-2-ylprop-2-enenitrile?
The IUPAC name of (Z)-3-(2,5-dimethylthiophen-3-yl)-2-naphthalen-2-ylprop-2-enenitrile (CID 177385434) is (Z)-3-(2,5-dimethylthiophen-3-yl)-2-naphthalen-2-ylprop-2-enenitrile.
What is the SMILES notation for (Z)-3-(2,5-dimethylthiophen-3-yl)-2-naphthalen-2-ylprop-2-enenitrile?
The canonical SMILES for (Z)-3-(2,5-dimethylthiophen-3-yl)-2-naphthalen-2-ylprop-2-enenitrile is Cc1cc(/C=C(\C#N)c2ccc3ccccc3c2)c(C)s1.
What is the InChIKey of (Z)-3-(2,5-dimethylthiophen-3-yl)-2-naphthalen-2-ylprop-2-enenitrile?
The InChIKey is KGZMRIGGNBPYFQ-YBFXNURJSA-N. The full InChI is InChI=1S/C19H15NS/c1-13-9-18(14(2)21-13)11-19(12-20)17-8-7-15-5-3-4-6-16(15)10-17/h3-11H,1-2H3/b19-11+.
What are the key properties of (Z)-3-(2,5-dimethylthiophen-3-yl)-2-naphthalen-2-ylprop-2-enenitrile?
(Z)-3-(2,5-dimethylthiophen-3-yl)-2-naphthalen-2-ylprop-2-enenitrile has a molecular weight of 289.40 g/mol, XLogP of 5.58, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-3-(2,5-dimethylthiophen-3-yl)-2-naphthalen-2-ylprop-2-enenitrile is sourced from PubChem (CID 177385434), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).