C22H32N2O6 — CID 177386963
(1R,2E)-1-[(3aR,5R,6S,6aR)-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-2-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]iminoethanol (PubChem CID 177386963) has the molecular formula C22H32N2O6 and a molecular weight of 420.51 g/mol. Its IUPAC name is (1R,2E)-1-[(3aR,5R,6S,6aR)-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-2-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]iminoethanol.
| Compound Name | (1R,2E)-1-[(3aR,5R,6S,6aR)-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-2-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]iminoethanol |
|---|---|
| PubChem CID | 177386963 |
| Molecular Formula | C22H32N2O6 |
| Molecular Weight | 420.51 g/mol |
| Exact Mass | 420.23 |
| IUPAC Name | (1R,2E)-1-[(3aR,5R,6S,6aR)-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-2-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]iminoethanol |
| SMILES | COC[C@@H]1CCCN1/N=C/[C@@H](O)[C@H]1O[C@@H]2OC(C)(C)O[C@@H]2[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C22H32N2O6/c1-22(2)29-20-19(27-13-15-8-5-4-6-9-15)18(28-21(20)30-22)17(25)12-23-24-11-7-10-16(24)14-26-3/h4-6,8-9,12,16-21,25H,7,10-11,13-14H2,1-3H3/b23-12+/t16-,17+,18+,19-,20+,21+/m0/s1 |
| InChIKey | UIMWTSGKGXLJFK-SCSCIMCASA-N |
| XLogP | 1.91 |
| TPSA | 81.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.51 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|