C20H28N2O5 — CID 10926911
(1R,2E)-1-[(3aR,5R,6S,6aR)-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-2-pyrrolidin-1-yliminoethanol (PubChem CID 10926911) has the molecular formula C20H28N2O5 and a molecular weight of 376.45 g/mol. Its IUPAC name is (1R,2E)-1-[(3aR,5R,6S,6aR)-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-2-pyrrolidin-1-yliminoethanol.
| Compound Name | (1R,2E)-1-[(3aR,5R,6S,6aR)-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-2-pyrrolidin-1-yliminoethanol |
|---|---|
| PubChem CID | 10926911 |
| Molecular Formula | C20H28N2O5 |
| Molecular Weight | 376.45 g/mol |
| Exact Mass | 376.20 |
| IUPAC Name | (1R,2E)-1-[(3aR,5R,6S,6aR)-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-2-pyrrolidin-1-yliminoethanol |
| SMILES | CC1(C)O[C@H]2O[C@H]([C@H](O)/C=N/N3CCCC3)[C@H](OCc3ccccc3)[C@H]2O1 |
| InChI | InChI=1S/C20H28N2O5/c1-20(2)26-18-17(24-13-14-8-4-3-5-9-14)16(25-19(18)27-20)15(23)12-21-22-10-6-7-11-22/h3-5,8-9,12,15-19,23H,6-7,10-11,13H2,1-2H3/b21-12+/t15-,16-,17+,18-,19-/m1/s1 |
| InChIKey | KVOQOVWDSJBGDO-DFFSQLRMSA-N |
| XLogP | 1.89 |
| TPSA | 72.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.45 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|