C18H26N2O3 — CID 134875011
(E,2S)-2-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-phenylmethoxy-N-pyrrolidin-1-ylethanimine (PubChem CID 134875011) has the molecular formula C18H26N2O3 and a molecular weight of 318.42 g/mol. Its IUPAC name is (E,2S)-2-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-phenylmethoxy-N-pyrrolidin-1-ylethanimine.
| Compound Name | (E,2S)-2-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-phenylmethoxy-N-pyrrolidin-1-ylethanimine |
|---|---|
| PubChem CID | 134875011 |
| Molecular Formula | C18H26N2O3 |
| Molecular Weight | 318.42 g/mol |
| Exact Mass | 318.19 |
| IUPAC Name | (E,2S)-2-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-phenylmethoxy-N-pyrrolidin-1-ylethanimine |
| SMILES | CC1(C)OC[C@H]([C@H](/C=N/N2CCCC2)OCc2ccccc2)O1 |
| InChI | InChI=1S/C18H26N2O3/c1-18(2)22-14-17(23-18)16(12-19-20-10-6-7-11-20)21-13-15-8-4-3-5-9-15/h3-5,8-9,12,16-17H,6-7,10-11,13-14H2,1-2H3/b19-12+/t16-,17+/m0/s1 |
| InChIKey | PTXCIQWRPHJALE-LJNFXEMMSA-N |
| XLogP | 2.80 |
| TPSA | 43.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.42 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|