C20H30N2O2 — CID 10914513
(E,2R)-N-[(2S)-2-(2-methoxypropan-2-yl)pyrrolidin-1-yl]-2-phenylmethoxypent-4-en-1-imine (PubChem CID 10914513) has the molecular formula C20H30N2O2 and a molecular weight of 330.47 g/mol. Its IUPAC name is (E,2R)-N-[(2S)-2-(2-methoxypropan-2-yl)pyrrolidin-1-yl]-2-phenylmethoxypent-4-en-1-imine.
| Compound Name | (E,2R)-N-[(2S)-2-(2-methoxypropan-2-yl)pyrrolidin-1-yl]-2-phenylmethoxypent-4-en-1-imine |
|---|---|
| PubChem CID | 10914513 |
| Molecular Formula | C20H30N2O2 |
| Molecular Weight | 330.47 g/mol |
| Exact Mass | 330.23 |
| IUPAC Name | (E,2R)-N-[(2S)-2-(2-methoxypropan-2-yl)pyrrolidin-1-yl]-2-phenylmethoxypent-4-en-1-imine |
| SMILES | C=CC[C@H](/C=N/N1CCC[C@H]1C(C)(C)OC)OCc1ccccc1 |
| InChI | InChI=1S/C20H30N2O2/c1-5-10-18(24-16-17-11-7-6-8-12-17)15-21-22-14-9-13-19(22)20(2,3)23-4/h5-8,11-12,15,18-19H,1,9-10,13-14,16H2,2-4H3/b21-15+/t18-,19+/m1/s1 |
| InChIKey | LQVOGTKUPLXSTK-SNXZXXCMSA-N |
| XLogP | 4.02 |
| TPSA | 34.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.47 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|