C17H26N2O2 — CID 24905695
(E,2R)-N-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]-2-phenylmethoxybutan-1-imine (PubChem CID 24905695) has the molecular formula C17H26N2O2 and a molecular weight of 290.41 g/mol. Its IUPAC name is (E,2R)-N-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]-2-phenylmethoxybutan-1-imine.
| Compound Name | (E,2R)-N-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]-2-phenylmethoxybutan-1-imine |
|---|---|
| PubChem CID | 24905695 |
| Molecular Formula | C17H26N2O2 |
| Molecular Weight | 290.41 g/mol |
| Exact Mass | 290.20 |
| IUPAC Name | (E,2R)-N-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]-2-phenylmethoxybutan-1-imine |
| SMILES | CC[C@H](/C=N/N1CCC[C@H]1COC)OCc1ccccc1 |
| InChI | InChI=1S/C17H26N2O2/c1-3-17(21-13-15-8-5-4-6-9-15)12-18-19-11-7-10-16(19)14-20-2/h4-6,8-9,12,16-17H,3,7,10-11,13-14H2,1-2H3/b18-12+/t16-,17+/m0/s1 |
| InChIKey | OXEZKAJJOKUCAY-TYUUCJPQSA-N |
| XLogP | 3.08 |
| TPSA | 34.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.41 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|