C19H22N2O — CID 10661477
N-[(2S)-2-[methoxy(diphenyl)methyl]pyrrolidin-1-yl]methanimine (PubChem CID 10661477) has the molecular formula C19H22N2O and a molecular weight of 294.40 g/mol. Its IUPAC name is N-[(2S)-2-[methoxy(diphenyl)methyl]pyrrolidin-1-yl]methanimine.
| Compound Name | N-[(2S)-2-[methoxy(diphenyl)methyl]pyrrolidin-1-yl]methanimine |
|---|---|
| PubChem CID | 10661477 |
| Molecular Formula | C19H22N2O |
| Molecular Weight | 294.40 g/mol |
| Exact Mass | 294.17 |
| IUPAC Name | N-[(2S)-2-[methoxy(diphenyl)methyl]pyrrolidin-1-yl]methanimine |
| SMILES | C=NN1CCC[C@H]1C(OC)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C19H22N2O/c1-20-21-15-9-14-18(21)19(22-2,16-10-5-3-6-11-16)17-12-7-4-8-13-17/h3-8,10-13,18H,1,9,14-15H2,2H3/t18-/m0/s1 |
| InChIKey | IVEIAAJOFLWEKB-SFHVURJKSA-N |
| XLogP | 3.66 |
| TPSA | 24.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.40 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|