C33H35NOSi — CID 132597649
[diphenyl-[(2S)-1-[(E)-prop-1-enyl]pyrrolidin-2-yl]methoxy]-methyl-diphenylsilane (PubChem CID 132597649) has the molecular formula C33H35NOSi and a molecular weight of 489.74 g/mol. Its IUPAC name is [diphenyl-[(2S)-1-[(E)-prop-1-enyl]pyrrolidin-2-yl]methoxy]-methyl-diphenylsilane.
| Compound Name | [diphenyl-[(2S)-1-[(E)-prop-1-enyl]pyrrolidin-2-yl]methoxy]-methyl-diphenylsilane |
|---|---|
| PubChem CID | 132597649 |
| Molecular Formula | C33H35NOSi |
| Molecular Weight | 489.74 g/mol |
| Exact Mass | 489.25 |
| IUPAC Name | [diphenyl-[(2S)-1-[(E)-prop-1-enyl]pyrrolidin-2-yl]methoxy]-methyl-diphenylsilane |
| SMILES | C/C=C/N1CCC[C@H]1C(O[Si](C)(c1ccccc1)c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C33H35NOSi/c1-3-26-34-27-16-25-32(34)33(28-17-8-4-9-18-28,29-19-10-5-11-20-29)35-36(2,30-21-12-6-13-22-30)31-23-14-7-15-24-31/h3-15,17-24,26,32H,16,25,27H2,1-2H3/b26-3+/t32-/m0/s1 |
| InChIKey | RQIQLKGZHQVBJE-DEYAGCHNSA-N |
| XLogP | 6.33 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.74 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|