C36H39NOSi — CID 177392334
[[(2S)-1-(cyclohexen-1-yl)pyrrolidin-2-yl]-diphenylmethoxy]-methyl-diphenylsilane (PubChem CID 177392334) has the molecular formula C36H39NOSi and a molecular weight of 529.80 g/mol. Its IUPAC name is [[(2S)-1-(cyclohexen-1-yl)pyrrolidin-2-yl]-diphenylmethoxy]-methyl-diphenylsilane.
| Compound Name | [[(2S)-1-(cyclohexen-1-yl)pyrrolidin-2-yl]-diphenylmethoxy]-methyl-diphenylsilane |
|---|---|
| PubChem CID | 177392334 |
| Molecular Formula | C36H39NOSi |
| Molecular Weight | 529.80 g/mol |
| Exact Mass | 529.28 |
| IUPAC Name | [[(2S)-1-(cyclohexen-1-yl)pyrrolidin-2-yl]-diphenylmethoxy]-methyl-diphenylsilane |
| SMILES | C[Si](OC(c1ccccc1)(c1ccccc1)[C@@H]1CCCN1C1=CCCCC1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C36H39NOSi/c1-39(33-24-13-5-14-25-33,34-26-15-6-16-27-34)38-36(30-18-7-2-8-19-30,31-20-9-3-10-21-31)35-28-17-29-37(35)32-22-11-4-12-23-32/h2-3,5-10,13-16,18-22,24-27,35H,4,11-12,17,23,28-29H2,1H3/t35-/m0/s1 |
| InChIKey | OTVJVQCXYGWERQ-DHUJRADRSA-N |
| XLogP | 7.26 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.80 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|