C17H28N2O2 — CID 134877011
N-methyl-N-[(E)-2-(phenylmethoxymethoxy)heptylideneamino]methanamine (PubChem CID 134877011) has the molecular formula C17H28N2O2 and a molecular weight of 292.42 g/mol. Its IUPAC name is N-methyl-N-[(E)-2-(phenylmethoxymethoxy)heptylideneamino]methanamine.
| Compound Name | N-methyl-N-[(E)-2-(phenylmethoxymethoxy)heptylideneamino]methanamine |
|---|---|
| PubChem CID | 134877011 |
| Molecular Formula | C17H28N2O2 |
| Molecular Weight | 292.42 g/mol |
| Exact Mass | 292.22 |
| IUPAC Name | N-methyl-N-[(E)-2-(phenylmethoxymethoxy)heptylideneamino]methanamine |
| SMILES | CCCCCC(/C=N/N(C)C)OCOCc1ccccc1 |
| InChI | InChI=1S/C17H28N2O2/c1-4-5-7-12-17(13-18-19(2)3)21-15-20-14-16-10-8-6-9-11-16/h6,8-11,13,17H,4-5,7,12,14-15H2,1-3H3/b18-13+ |
| InChIKey | FKWBTFJBYJHQBM-QGOAFFKASA-N |
| XLogP | 3.67 |
| TPSA | 34.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.42 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|