C15H21NO4 — CID 134876798
(4R,6R)-6-butoxy-2-oxido-4-phenylmethoxy-5,6-dihydro-4H-oxazin-2-ium (PubChem CID 134876798) has the molecular formula C15H21NO4 and a molecular weight of 279.34 g/mol. Its IUPAC name is (4R,6R)-6-butoxy-2-oxido-4-phenylmethoxy-5,6-dihydro-4H-oxazin-2-ium.
| Compound Name | (4R,6R)-6-butoxy-2-oxido-4-phenylmethoxy-5,6-dihydro-4H-oxazin-2-ium |
|---|---|
| PubChem CID | 134876798 |
| Molecular Formula | C15H21NO4 |
| Molecular Weight | 279.34 g/mol |
| Exact Mass | 279.15 |
| IUPAC Name | (4R,6R)-6-butoxy-2-oxido-4-phenylmethoxy-5,6-dihydro-4H-oxazin-2-ium |
| SMILES | CCCCO[C@H]1C[C@@H](OCc2ccccc2)C=[N+]([O-])O1 |
| InChI | InChI=1S/C15H21NO4/c1-2-3-9-18-15-10-14(11-16(17)20-15)19-12-13-7-5-4-6-8-13/h4-8,11,14-15H,2-3,9-10,12H2,1H3/t14-,15-/m1/s1 |
| InChIKey | YVWBOZJJOTVWDX-HUUCEWRRSA-N |
| XLogP | 2.63 |
| TPSA | 53.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.34 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|