C18H19F2NO2 — CID 15038957
(E,2R)-3,3-difluoro-N,2-bis(phenylmethoxy)butan-1-imine (PubChem CID 15038957) has the molecular formula C18H19F2NO2 and a molecular weight of 319.35 g/mol. Its IUPAC name is (E,2R)-3,3-difluoro-N,2-bis(phenylmethoxy)butan-1-imine.
| Compound Name | (E,2R)-3,3-difluoro-N,2-bis(phenylmethoxy)butan-1-imine |
|---|---|
| PubChem CID | 15038957 |
| Molecular Formula | C18H19F2NO2 |
| Molecular Weight | 319.35 g/mol |
| Exact Mass | 319.14 |
| IUPAC Name | (E,2R)-3,3-difluoro-N,2-bis(phenylmethoxy)butan-1-imine |
| SMILES | CC(F)(F)[C@@H](/C=N/OCc1ccccc1)OCc1ccccc1 |
| InChI | InChI=1S/C18H19F2NO2/c1-18(19,20)17(22-13-15-8-4-2-5-9-15)12-21-23-14-16-10-6-3-7-11-16/h2-12,17H,13-14H2,1H3/b21-12+/t17-/m1/s1 |
| InChIKey | OCQYBWDRUIFUOD-KKJJZKEWSA-N |
| XLogP | 4.43 |
| TPSA | 30.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.35 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|