C17H18F5NO2 — CID 91749555
(E)-N-[(2,3,4,5,6-pentafluorophenyl)methoxy]-3-(3-pentyloxiran-2-yl)prop-2-en-1-imine (PubChem CID 91749555) has the molecular formula C17H18F5NO2 and a molecular weight of 363.33 g/mol. Its IUPAC name is (E)-N-[(2,3,4,5,6-pentafluorophenyl)methoxy]-3-(3-pentyloxiran-2-yl)prop-2-en-1-imine.
| Compound Name | (E)-N-[(2,3,4,5,6-pentafluorophenyl)methoxy]-3-(3-pentyloxiran-2-yl)prop-2-en-1-imine |
|---|---|
| PubChem CID | 91749555 |
| Molecular Formula | C17H18F5NO2 |
| Molecular Weight | 363.33 g/mol |
| Exact Mass | 363.13 |
| IUPAC Name | (E)-N-[(2,3,4,5,6-pentafluorophenyl)methoxy]-3-(3-pentyloxiran-2-yl)prop-2-en-1-imine |
| SMILES | CCCCCC1OC1/C=C/C=NOCc1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C17H18F5NO2/c1-2-3-4-6-11-12(25-11)7-5-8-23-24-9-10-13(18)15(20)17(22)16(21)14(10)19/h5,7-8,11-12H,2-4,6,9H2,1H3/b7-5+,23-8? |
| InChIKey | XWSHGXHSCROHSI-MFOUKIMPSA-N |
| XLogP | 4.79 |
| TPSA | 34.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.33 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|