C16H16F5NO — CID 91740472
(E,2E,4E)-N-[(2,3,4,5,6-pentafluorophenyl)methoxy]nona-2,4-dien-1-imine (PubChem CID 91740472) has the molecular formula C16H16F5NO and a molecular weight of 333.30 g/mol. Its IUPAC name is (E,2E,4E)-N-[(2,3,4,5,6-pentafluorophenyl)methoxy]nona-2,4-dien-1-imine.
| Compound Name | (E,2E,4E)-N-[(2,3,4,5,6-pentafluorophenyl)methoxy]nona-2,4-dien-1-imine |
|---|---|
| PubChem CID | 91740472 |
| Molecular Formula | C16H16F5NO |
| Molecular Weight | 333.30 g/mol |
| Exact Mass | 333.12 |
| IUPAC Name | (E,2E,4E)-N-[(2,3,4,5,6-pentafluorophenyl)methoxy]nona-2,4-dien-1-imine |
| SMILES | CCCC/C=C/C=C/C=N/OCc1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C16H16F5NO/c1-2-3-4-5-6-7-8-9-22-23-10-11-12(17)14(19)16(21)15(20)13(11)18/h5-9H,2-4,10H2,1H3/b6-5+,8-7+,22-9+ |
| InChIKey | DEXKLLPZRSMCAS-QGUPEEGPSA-N |
| XLogP | 5.19 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.30 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|